C16H16N2OS — CID 969407
N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,5-dimethylbenzamide (PubChem CID 969407) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,5-dimethylbenzamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 969407 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2sc(C)c(C)c2C#N)c1 |
| InChI | InChI=1S/C16H16N2OS/c1-9-5-10(2)7-13(6-9)15(19)18-16-14(8-17)11(3)12(4)20-16/h5-7H,1-4H3,(H,18,19) |
| InChIKey | GHBWZORTIIDLJQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |