C8H9N3OS — CID 130621892
(3-cyano-4,5-dimethylthiophen-2-yl)urea (PubChem CID 130621892) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is (3-cyano-4,5-dimethylthiophen-2-yl)urea.
| Compound Name | (3-cyano-4,5-dimethylthiophen-2-yl)urea |
|---|---|
| PubChem CID | 130621892 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (3-cyano-4,5-dimethylthiophen-2-yl)urea |
| SMILES | Cc1sc(NC(N)=O)c(C#N)c1C |
| InChI | InChI=1S/C8H9N3OS/c1-4-5(2)13-7(6(4)3-9)11-8(10)12/h1-2H3,(H3,10,11,12) |
| InChIKey | WSCVSBNTOAVPJU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |