C9H9IN2OS — CID 64787572
N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-iodoacetamide (PubChem CID 64787572) has the molecular formula C9H9IN2OS and a molecular weight of 320.16 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-iodoacetamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-iodoacetamide |
|---|---|
| PubChem CID | 64787572 |
| Molecular Formula | C9H9IN2OS |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-iodoacetamide |
| SMILES | Cc1sc(NC(=O)CI)c(C#N)c1C |
| InChI | InChI=1S/C9H9IN2OS/c1-5-6(2)14-9(7(5)4-11)12-8(13)3-10/h3H2,1-2H3,(H,12,13) |
| InChIKey | SQHMDMKETAAMOG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|