C17H26N2OS — CID 4289593
N-(3-cyano-4,5-dimethylthiophen-2-yl)decanamide (PubChem CID 4289593) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)decanamide.
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)decanamide |
|---|---|
| PubChem CID | 4289593 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1sc(C)c(C)c1C#N |
| InChI | InChI=1S/C17H26N2OS/c1-4-5-6-7-8-9-10-11-16(20)19-17-15(12-18)13(2)14(3)21-17/h4-11H2,1-3H3,(H,19,20) |
| InChIKey | VUQCIBBDSMTCHS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|