C18H26N2OS — CID 3334122
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)heptanamide (PubChem CID 3334122) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)heptanamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)heptanamide |
|---|---|
| PubChem CID | 3334122 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)heptanamide |
| SMILES | CCCCCCC(=O)Nc1sc2c(c1C#N)CCCCCC2 |
| InChI | InChI=1S/C18H26N2OS/c1-2-3-4-9-12-17(21)20-18-15(13-19)14-10-7-5-6-8-11-16(14)22-18/h2-12H2,1H3,(H,20,21) |
| InChIKey | DFBCCNLNJYWABA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|