C20H31NO3S — CID 3368502
propyl 2-(octanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3368502) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is propyl 2-(octanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propyl 2-(octanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3368502 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | propyl 2-(octanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCCCCC(=O)Nc1sc2c(c1C(=O)OCCC)CCCC2 |
| InChI | InChI=1S/C20H31NO3S/c1-3-5-6-7-8-13-17(22)21-19-18(20(23)24-14-4-2)15-11-9-10-12-16(15)25-19/h3-14H2,1-2H3,(H,21,22) |
| InChIKey | PALNPWGSALOCFC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|