C23H27Cl2NO4S — CID 4146940
propyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 4146940) has the molecular formula C23H27Cl2NO4S and a molecular weight of 484.45 g/mol. Its IUPAC name is propyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | propyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4146940 |
| Molecular Formula | C23H27Cl2NO4S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | propyl 2-[4-(2,4-dichlorophenoxy)butanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)CCCOc2ccc(Cl)cc2Cl)sc2c1CCCCC2 |
| InChI | InChI=1S/C23H27Cl2NO4S/c1-2-12-30-23(28)21-16-7-4-3-5-8-19(16)31-22(21)26-20(27)9-6-13-29-18-11-10-15(24)14-17(18)25/h10-11,14H,2-9,12-13H2,1H3,(H,26,27) |
| InChIKey | VJBJRYZTMWTJHD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|