C21H24ClNO4S — CID 19191253
ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19191253) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19191253 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccc(Cl)c(C)c2)sc2c1CCC2 |
| InChI | InChI=1S/C21H24ClNO4S/c1-3-26-21(25)19-15-6-4-7-17(15)28-20(19)23-18(24)8-5-11-27-14-9-10-16(22)13(2)12-14/h9-10,12H,3-8,11H2,1-2H3,(H,23,24) |
| InChIKey | KBVWAXCXGYGCQH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|