C17H14Cl3NO3S — CID 19171025
ethyl 2-[(2,3,6-trichlorobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19171025) has the molecular formula C17H14Cl3NO3S and a molecular weight of 418.73 g/mol. Its IUPAC name is ethyl 2-[(2,3,6-trichlorobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2,3,6-trichlorobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19171025 |
| Molecular Formula | C17H14Cl3NO3S |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | ethyl 2-[(2,3,6-trichlorobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2c(Cl)ccc(Cl)c2Cl)sc2c1CCC2 |
| InChI | InChI=1S/C17H14Cl3NO3S/c1-2-24-17(23)12-8-4-3-5-11(8)25-16(12)21-15(22)13-9(18)6-7-10(19)14(13)20/h6-7H,2-5H2,1H3,(H,21,22) |
| InChIKey | XFOYDKSONSBDGK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|