C16H13Cl3N2O2S — CID 19171118
2-[(2,3,6-trichlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19171118) has the molecular formula C16H13Cl3N2O2S and a molecular weight of 403.72 g/mol. Its IUPAC name is 2-[(2,3,6-trichlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(2,3,6-trichlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19171118 |
| Molecular Formula | C16H13Cl3N2O2S |
| Molecular Weight | 403.72 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 2-[(2,3,6-trichlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2c(Cl)ccc(Cl)c2Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C16H13Cl3N2O2S/c17-8-5-6-9(18)13(19)12(8)15(23)21-16-11(14(20)22)7-3-1-2-4-10(7)24-16/h5-6H,1-4H2,(H2,20,22)(H,21,23) |
| InChIKey | SMDFLKMZMRIUTN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.72 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|