C17H15Cl2FN2O2S — CID 55386703
2-[(2,4-dichloro-5-fluorobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 55386703) has the molecular formula C17H15Cl2FN2O2S and a molecular weight of 401.29 g/mol. Its IUPAC name is 2-[(2,4-dichloro-5-fluorobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(2,4-dichloro-5-fluorobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55386703 |
| Molecular Formula | C17H15Cl2FN2O2S |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2-[(2,4-dichloro-5-fluorobenzoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2cc(F)c(Cl)cc2Cl)sc2c1CCCCC2 |
| InChI | InChI=1S/C17H15Cl2FN2O2S/c18-10-7-11(19)12(20)6-9(10)16(24)22-17-14(15(21)23)8-4-2-1-3-5-13(8)25-17/h6-7H,1-5H2,(H2,21,23)(H,22,24) |
| InChIKey | NCWIEUUWKOMNIB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|