C25H33NO5S — CID 19236939
ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19236939) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19236939 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCCCOc1ccc(CCC(=O)Nc2sc3c(c2C(=O)OCC)CCC3)cc1OCC |
| InChI | InChI=1S/C25H33NO5S/c1-4-7-15-31-19-13-11-17(16-20(19)29-5-2)12-14-22(27)26-24-23(25(28)30-6-3)18-9-8-10-21(18)32-24/h11,13,16H,4-10,12,14-15H2,1-3H3,(H,26,27) |
| InChIKey | AYVZMUOAIPIMFZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|