C28H33NO5S — CID 19236953
ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 19236953) has the molecular formula C28H33NO5S and a molecular weight of 495.64 g/mol. Its IUPAC name is ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19236953 |
| Molecular Formula | C28H33NO5S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | ethyl 2-[3-(4-butoxy-3-ethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCCCOc1ccc(CCC(=O)Nc2scc(-c3ccccc3)c2C(=O)OCC)cc1OCC |
| InChI | InChI=1S/C28H33NO5S/c1-4-7-17-34-23-15-13-20(18-24(23)32-5-2)14-16-25(30)29-27-26(28(31)33-6-3)22(19-35-27)21-11-9-8-10-12-21/h8-13,15,18-19H,4-7,14,16-17H2,1-3H3,(H,29,30) |
| InChIKey | JTGFVXMOVWRBEY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|