C24H24BrNO5S — CID 2071409
ethyl 2-[3-(2-bromo-4,5-dimethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 2071409) has the molecular formula C24H24BrNO5S and a molecular weight of 518.43 g/mol. Its IUPAC name is ethyl 2-[3-(2-bromo-4,5-dimethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(2-bromo-4,5-dimethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2071409 |
| Molecular Formula | C24H24BrNO5S |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | ethyl 2-[3-(2-bromo-4,5-dimethoxyphenyl)propanoylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C24H24BrNO5S/c1-4-31-24(28)22-17(15-8-6-5-7-9-15)14-32-23(22)26-21(27)11-10-16-12-19(29-2)20(30-3)13-18(16)25/h5-9,12-14H,4,10-11H2,1-3H3,(H,26,27) |
| InChIKey | LKEQGVJXAUJNHG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|