C25H25BrClNO4S — CID 19205961
ethyl 2-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 19205961) has the molecular formula C25H25BrClNO4S and a molecular weight of 550.90 g/mol. Its IUPAC name is ethyl 2-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19205961 |
| Molecular Formula | C25H25BrClNO4S |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 549.04 |
| IUPAC Name | ethyl 2-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CCCOc1cc(C)c(Cl)c(C)c1Br |
| InChI | InChI=1S/C25H25BrClNO4S/c1-4-31-25(30)21-18(17-9-6-5-7-10-17)14-33-24(21)28-20(29)11-8-12-32-19-13-15(2)23(27)16(3)22(19)26/h5-7,9-10,13-14H,4,8,11-12H2,1-3H3,(H,28,29) |
| InChIKey | LWBBSIUMGPIVSU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|