C27H30BrNO5S — CID 19203044
ethyl 2-[4-(2-bromo-4-ethylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate (PubChem CID 19203044) has the molecular formula C27H30BrNO5S and a molecular weight of 560.51 g/mol. Its IUPAC name is ethyl 2-[4-(2-bromo-4-ethylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(2-bromo-4-ethylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19203044 |
| Molecular Formula | C27H30BrNO5S |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | ethyl 2-[4-(2-bromo-4-ethylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC)cc2)csc1NC(=O)CCCOc1ccc(CC)cc1Br |
| InChI | InChI=1S/C27H30BrNO5S/c1-4-18-9-14-23(22(28)16-18)34-15-7-8-24(30)29-26-25(27(31)33-6-3)21(17-35-26)19-10-12-20(13-11-19)32-5-2/h9-14,16-17H,4-8,15H2,1-3H3,(H,29,30) |
| InChIKey | VCVHDFVVGMVSSP-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|