C28H33NO5S — CID 19184052
ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 19184052) has the molecular formula C28H33NO5S and a molecular weight of 495.64 g/mol. Its IUPAC name is ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19184052 |
| Molecular Formula | C28H33NO5S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)CCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H33NO5S/c1-6-33-27(31)25-23(19-9-13-21(32-5)14-10-19)18-35-26(25)29-24(30)8-7-17-34-22-15-11-20(12-16-22)28(2,3)4/h9-16,18H,6-8,17H2,1-5H3,(H,29,30) |
| InChIKey | SKUGTPONZWAEHO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|