C25H33NO6S — CID 2790648
diethyl 5-[4-(4-tert-butylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2790648) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is diethyl 5-[4-(4-tert-butylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[4-(4-tert-butylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2790648 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | diethyl 5-[4-(4-tert-butylphenoxy)butanoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C25H33NO6S/c1-7-30-23(28)20-16(3)21(24(29)31-8-2)33-22(20)26-19(27)10-9-15-32-18-13-11-17(12-14-18)25(4,5)6/h11-14H,7-10,15H2,1-6H3,(H,26,27) |
| InChIKey | FCHVIMRPTHMMDI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|