C25H33NO7 — CID 108762202
diethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-5-methylfuran-3,4-dicarboxylate (PubChem CID 108762202) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is diethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108762202 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | diethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)CCCOc2ccc(C(C)(C)C)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C25H33NO7/c1-7-30-23(28)20-16(3)33-22(21(20)24(29)31-8-2)26-19(27)10-9-15-32-18-13-11-17(12-14-18)25(4,5)6/h11-14H,7-10,15H2,1-6H3,(H,26,27) |
| InChIKey | NBLWNDVOHIAGLR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|