C22H27NO5S — CID 8600996
ethyl 4-acetyl-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-5-methylfuran-3-carboxylate (PubChem CID 8600996) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8600996 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | ethyl 4-acetyl-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2ccc(C(C)(C)C)cc2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C22H27NO5S/c1-7-27-21(26)19-18(13(2)24)14(3)28-20(19)23-17(25)12-29-16-10-8-15(9-11-16)22(4,5)6/h8-11H,7,12H2,1-6H3,(H,23,25) |
| InChIKey | IHQPNHMHYXVNLN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |