C13H14N2O5 — CID 108763526
ethyl 4-acetyl-2-[(2-cyanoacetyl)amino]-5-methylfuran-3-carboxylate (PubChem CID 108763526) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[(2-cyanoacetyl)amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[(2-cyanoacetyl)amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108763526 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl 4-acetyl-2-[(2-cyanoacetyl)amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CC#N)oc(C)c1C(C)=O |
| InChI | InChI=1S/C13H14N2O5/c1-4-19-13(18)11-10(7(2)16)8(3)20-12(11)15-9(17)5-6-14/h4-5H2,1-3H3,(H,15,17) |
| InChIKey | JADQZCSKMARKGT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |