C19H20N2O6 — CID 108763529
ethyl 4-acetyl-2-[(2-benzamidoacetyl)amino]-5-methylfuran-3-carboxylate (PubChem CID 108763529) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[(2-benzamidoacetyl)amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[(2-benzamidoacetyl)amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108763529 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | ethyl 4-acetyl-2-[(2-benzamidoacetyl)amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CNC(=O)c2ccccc2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C19H20N2O6/c1-4-26-19(25)16-15(11(2)22)12(3)27-18(16)21-14(23)10-20-17(24)13-8-6-5-7-9-13/h5-9H,4,10H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | AHFFIIVNYVUAMM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |