C26H27NO6 — CID 108739525
diethyl 2-(3,3-diphenylpropanoylamino)-5-methylfuran-3,4-dicarboxylate (PubChem CID 108739525) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is diethyl 2-(3,3-diphenylpropanoylamino)-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-(3,3-diphenylpropanoylamino)-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108739525 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | diethyl 2-(3,3-diphenylpropanoylamino)-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)CC(c2ccccc2)c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C26H27NO6/c1-4-31-25(29)22-17(3)33-24(23(22)26(30)32-5-2)27-21(28)16-20(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20H,4-5,16H2,1-3H3,(H,27,28) |
| InChIKey | LZXMSQKLILWLTE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |