About diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate
diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate (PubChem CID 39765919) has the molecular formula C23H24N2O6S
and a molecular weight of 456.52 g/mol. Its IUPAC name is diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate |
| PubChem CID | 39765919 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)CCSc2ccc3ccccc3n2)c1C(=O)OCC |
| InChI | InChI=1S/C23H24N2O6S/c1-4-29-22(27)19-14(3)31-21(20(19)23(28)30-5-2)25-17(26)12-13-32-18-11-10-15-8-6-7-9-16(15)24-18/h6-11H,4-5,12-13H2,1-3H3,(H,25,26) |
| InChIKey | MECNXUVNZNREEB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate?
The IUPAC name of diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate (CID 39765919) is diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate?
The canonical SMILES for diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate is CCOC(=O)c1c(C)oc(NC(=O)CCSc2ccc3ccccc3n2)c1C(=O)OCC.
What is the InChIKey of diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate?
The InChIKey is MECNXUVNZNREEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O6S/c1-4-29-22(27)19-14(3)31-21(20(19)23(28)30-5-2)25-17(26)12-13-32-18-11-10-15-8-6-7-9-16(15)24-18/h6-11H,4-5,12-13H2,1-3H3,(H,25,26).
What are the key properties of diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate?
diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate has a molecular weight of 456.52 g/mol, XLogP of 4.61, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-methyl-5-(3-quinolin-2-ylsulfanylpropanoylamino)furan-3,4-dicarboxylate is sourced from PubChem (CID 39765919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).