C21H17N3OS2 — CID 39765830
N-(4-phenyl-1,3-thiazol-2-yl)-3-quinolin-2-ylsulfanylpropanamide (PubChem CID 39765830) has the molecular formula C21H17N3OS2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-3-quinolin-2-ylsulfanylpropanamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-3-quinolin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 39765830 |
| Molecular Formula | C21H17N3OS2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-3-quinolin-2-ylsulfanylpropanamide |
| SMILES | O=C(CCSc1ccc2ccccc2n1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H17N3OS2/c25-19(24-21-23-18(14-27-21)15-6-2-1-3-7-15)12-13-26-20-11-10-16-8-4-5-9-17(16)22-20/h1-11,14H,12-13H2,(H,23,24,25) |
| InChIKey | ZQLXKKPCWSWQSW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |