C18H16N2OS — CID 840341
3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)propanamide (PubChem CID 840341) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 840341 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-phenyl-N-(4-phenyl-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H16N2OS/c21-17(12-11-14-7-3-1-4-8-14)20-18-19-16(13-22-18)15-9-5-2-6-10-15/h1-10,13H,11-12H2,(H,19,20,21) |
| InChIKey | USOKHTPKNMBBRG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |