C26H24N2O3S — CID 19220711
3-(3,4-dimethoxyphenyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 19220711) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 19220711 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2nc(-c3ccc(-c4ccccc4)cc3)cs2)cc1OC |
| InChI | InChI=1S/C26H24N2O3S/c1-30-23-14-8-18(16-24(23)31-2)9-15-25(29)28-26-27-22(17-32-26)21-12-10-20(11-13-21)19-6-4-3-5-7-19/h3-8,10-14,16-17H,9,15H2,1-2H3,(H,27,28,29) |
| InChIKey | OCMBRHQOPGHQEN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |