C20H19FN2O3S — CID 32622827
3-(3,4-dimethoxyphenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 32622827) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 32622827 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2nc(-c3cccc(F)c3)cs2)cc1OC |
| InChI | InChI=1S/C20H19FN2O3S/c1-25-17-8-6-13(10-18(17)26-2)7-9-19(24)23-20-22-16(12-27-20)14-4-3-5-15(21)11-14/h3-6,8,10-12H,7,9H2,1-2H3,(H,22,23,24) |
| InChIKey | HXSFWVOILOTHHM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |