C22H24N2O4S — CID 19220682
3-(3,4-dimethoxyphenyl)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 19220682) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 19220682 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)CCc3ccc(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-4-28-17-9-7-16(8-10-17)18-14-29-22(23-18)24-21(25)12-6-15-5-11-19(26-2)20(13-15)27-3/h5,7-11,13-14H,4,6,12H2,1-3H3,(H,23,24,25) |
| InChIKey | UQXYLBVFSDUDEI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |