C18H14F2N2OS — CID 32623275
3-(4-fluorophenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 32623275) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 32623275 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CCc1ccc(F)cc1)Nc1nc(-c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C18H14F2N2OS/c19-14-7-4-12(5-8-14)6-9-17(23)22-18-21-16(11-24-18)13-2-1-3-15(20)10-13/h1-5,7-8,10-11H,6,9H2,(H,21,22,23) |
| InChIKey | HUXGNUDSTQXTDW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |