C16H17FN2O2S — CID 51937676
N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-[(2S)-oxolan-2-yl]propanamide (PubChem CID 51937676) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-[(2S)-oxolan-2-yl]propanamide.
| Compound Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-[(2S)-oxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 51937676 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-3-[(2S)-oxolan-2-yl]propanamide |
| SMILES | O=C(CC[C@@H]1CCCO1)Nc1nc(-c2cccc(F)c2)cs1 |
| InChI | InChI=1S/C16H17FN2O2S/c17-12-4-1-3-11(9-12)14-10-22-16(18-14)19-15(20)7-6-13-5-2-8-21-13/h1,3-4,9-10,13H,2,5-8H2,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | XAOUCXIFVSGSGV-ZDUSSCGKSA-N |
| XLogP | 3.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |