C15H15FN2O3 — CID 154755202
N-[5-(3-fluorophenyl)-1,2-oxazol-3-yl]-2-(oxolan-2-yl)acetamide (PubChem CID 154755202) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)-1,2-oxazol-3-yl]-2-(oxolan-2-yl)acetamide.
| Compound Name | N-[5-(3-fluorophenyl)-1,2-oxazol-3-yl]-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 154755202 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[5-(3-fluorophenyl)-1,2-oxazol-3-yl]-2-(oxolan-2-yl)acetamide |
| SMILES | O=C(CC1CCCO1)Nc1cc(-c2cccc(F)c2)on1 |
| InChI | InChI=1S/C15H15FN2O3/c16-11-4-1-3-10(7-11)13-9-14(18-21-13)17-15(19)8-12-5-2-6-20-12/h1,3-4,7,9,12H,2,5-6,8H2,(H,17,18,19) |
| InChIKey | PNXVOURACYHWGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |