C14H13FN2O2 — CID 144981703
N-cyclobutyl-5-(3-fluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 144981703) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is N-cyclobutyl-5-(3-fluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-cyclobutyl-5-(3-fluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 144981703 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-cyclobutyl-5-(3-fluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCC1)c1cc(-c2cccc(F)c2)on1 |
| InChI | InChI=1S/C14H13FN2O2/c15-10-4-1-3-9(7-10)13-8-12(17-19-13)14(18)16-11-5-2-6-11/h1,3-4,7-8,11H,2,5-6H2,(H,16,18) |
| InChIKey | RIICYFMQCZAXQD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |