C16H17FN2O2 — CID 46472289
N-cyclohexyl-3-(3-fluorophenyl)-1,2-oxazole-5-carboxamide (PubChem CID 46472289) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is N-cyclohexyl-3-(3-fluorophenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-cyclohexyl-3-(3-fluorophenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 46472289 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-cyclohexyl-3-(3-fluorophenyl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(-c2cccc(F)c2)no1 |
| InChI | InChI=1S/C16H17FN2O2/c17-12-6-4-5-11(9-12)14-10-15(21-19-14)16(20)18-13-7-2-1-3-8-13/h4-6,9-10,13H,1-3,7-8H2,(H,18,20) |
| InChIKey | ZFFSUEYIVVASIA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |