C18H12FN3O5 — CID 46471021
N'-(1,3-benzodioxole-5-carbonyl)-3-(3-fluorophenyl)-1,2-oxazole-5-carbohydrazide (PubChem CID 46471021) has the molecular formula C18H12FN3O5 and a molecular weight of 369.31 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)-3-(3-fluorophenyl)-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)-3-(3-fluorophenyl)-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 46471021 |
| Molecular Formula | C18H12FN3O5 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)-3-(3-fluorophenyl)-1,2-oxazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2cccc(F)c2)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H12FN3O5/c19-12-3-1-2-10(6-12)13-8-16(27-22-13)18(24)21-20-17(23)11-4-5-14-15(7-11)26-9-25-14/h1-8H,9H2,(H,20,23)(H,21,24) |
| InChIKey | KDEPRJYYTFXVJV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|