C22H17FN2O5 — CID 34257431
N'-[3-[(4-fluorophenyl)methoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 34257431) has the molecular formula C22H17FN2O5 and a molecular weight of 408.39 g/mol. Its IUPAC name is N'-[3-[(4-fluorophenyl)methoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-[(4-fluorophenyl)methoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 34257431 |
| Molecular Formula | C22H17FN2O5 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N'-[3-[(4-fluorophenyl)methoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)OCO2)c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H17FN2O5/c23-17-7-4-14(5-8-17)12-28-18-3-1-2-15(10-18)21(26)24-25-22(27)16-6-9-19-20(11-16)30-13-29-19/h1-11H,12-13H2,(H,24,26)(H,25,27) |
| InChIKey | ZLYKPKADTXGUNR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|