C17H14N2O6 — CID 9401431
N'-(1,3-benzodioxole-5-carbonyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 9401431) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 9401431 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H14N2O6/c20-16(10-1-3-12-14(7-10)23-6-5-22-12)18-19-17(21)11-2-4-13-15(8-11)25-9-24-13/h1-4,7-8H,5-6,9H2,(H,18,20)(H,19,21) |
| InChIKey | OEBVILYDYJNJRA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|