C9H9N3O3S — CID 12654315
(1,3-benzodioxole-5-carbonylamino)thiourea (PubChem CID 12654315) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is (1,3-benzodioxole-5-carbonylamino)thiourea.
| Compound Name | (1,3-benzodioxole-5-carbonylamino)thiourea |
|---|---|
| PubChem CID | 12654315 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (1,3-benzodioxole-5-carbonylamino)thiourea |
| SMILES | NC(=S)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9N3O3S/c10-9(16)12-11-8(13)5-1-2-6-7(3-5)15-4-14-6/h1-3H,4H2,(H,11,13)(H3,10,12,16) |
| InChIKey | JTLSOJPZTHUXRT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|