C10H11N3O2S — CID 65216975
(1,3-dihydro-2-benzofuran-5-carbonylamino)thiourea (PubChem CID 65216975) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is (1,3-dihydro-2-benzofuran-5-carbonylamino)thiourea.
| Compound Name | (1,3-dihydro-2-benzofuran-5-carbonylamino)thiourea |
|---|---|
| PubChem CID | 65216975 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (1,3-dihydro-2-benzofuran-5-carbonylamino)thiourea |
| SMILES | NC(=S)NNC(=O)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C10H11N3O2S/c11-10(16)13-12-9(14)6-1-2-7-4-15-5-8(7)3-6/h1-3H,4-5H2,(H,12,14)(H3,11,13,16) |
| InChIKey | LQCVFQFOAHYMHG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|