C12H13NO2 — CID 49192019
N-prop-2-enyl-1,3-dihydro-2-benzofuran-5-carboxamide (PubChem CID 49192019) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-prop-2-enyl-1,3-dihydro-2-benzofuran-5-carboxamide.
| Compound Name | N-prop-2-enyl-1,3-dihydro-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 49192019 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-prop-2-enyl-1,3-dihydro-2-benzofuran-5-carboxamide |
| SMILES | C=CCNC(=O)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C12H13NO2/c1-2-5-13-12(14)9-3-4-10-7-15-8-11(10)6-9/h2-4,6H,1,5,7-8H2,(H,13,14) |
| InChIKey | OCHZZMQYZCCAFN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|