C13H16BrNO2 — CID 106846002
N-(4-bromobutyl)-1,3-dihydro-2-benzofuran-5-carboxamide (PubChem CID 106846002) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is N-(4-bromobutyl)-1,3-dihydro-2-benzofuran-5-carboxamide.
| Compound Name | N-(4-bromobutyl)-1,3-dihydro-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 106846002 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(4-bromobutyl)-1,3-dihydro-2-benzofuran-5-carboxamide |
| SMILES | O=C(NCCCCBr)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C13H16BrNO2/c14-5-1-2-6-15-13(16)10-3-4-11-8-17-9-12(11)7-10/h3-4,7H,1-2,5-6,8-9H2,(H,15,16) |
| InChIKey | GECBNJNRRWOIEB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|