C18H21N3O3 — CID 54451991
1-N,3-N,5-N-tris(prop-2-enyl)benzene-1,3,5-tricarboxamide (PubChem CID 54451991) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(prop-2-enyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(prop-2-enyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 54451991 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-N,3-N,5-N-tris(prop-2-enyl)benzene-1,3,5-tricarboxamide |
| SMILES | C=CCNC(=O)c1cc(C(=O)NCC=C)cc(C(=O)NCC=C)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-4-7-19-16(22)13-10-14(17(23)20-8-5-2)12-15(11-13)18(24)21-9-6-3/h4-6,10-12H,1-3,7-9H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | WVOTYMQQWTWNPD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|