C10H9ClFNO2 — CID 126791243
3-chloro-5-fluoro-4-hydroxy-N-prop-2-enylbenzamide (PubChem CID 126791243) has the molecular formula C10H9ClFNO2 and a molecular weight of 229.64 g/mol. Its IUPAC name is 3-chloro-5-fluoro-4-hydroxy-N-prop-2-enylbenzamide.
| Compound Name | 3-chloro-5-fluoro-4-hydroxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 126791243 |
| Molecular Formula | C10H9ClFNO2 |
| Molecular Weight | 229.64 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3-chloro-5-fluoro-4-hydroxy-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cc(F)c(O)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClFNO2/c1-2-3-13-10(15)6-4-7(11)9(14)8(12)5-6/h2,4-5,14H,1,3H2,(H,13,15) |
| InChIKey | GUQVFWFFZUGSSI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.64 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|