C9H10ClNO3 — CID 144617791
3-chloro-N-ethyl-4,5-dihydroxybenzamide (PubChem CID 144617791) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is 3-chloro-N-ethyl-4,5-dihydroxybenzamide.
| Compound Name | 3-chloro-N-ethyl-4,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 144617791 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 3-chloro-N-ethyl-4,5-dihydroxybenzamide |
| SMILES | CCNC(=O)c1cc(O)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClNO3/c1-2-11-9(14)5-3-6(10)8(13)7(12)4-5/h3-4,12-13H,2H2,1H3,(H,11,14) |
| InChIKey | WCSVVSAHIMTFAF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|