C16H16N2O7 — CID 108540173
N-[2-[(3,5-dihydroxybenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide (PubChem CID 108540173) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is N-[2-[(3,5-dihydroxybenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[2-[(3,5-dihydroxybenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108540173 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[2-[(3,5-dihydroxybenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(NCCNC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H16N2O7/c19-10-3-8(4-11(20)7-10)15(24)17-1-2-18-16(25)9-5-12(21)14(23)13(22)6-9/h3-7,19-23H,1-2H2,(H,17,24)(H,18,25) |
| InChIKey | RBUGVHOTDLULQH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|