C18H19N3O6 — CID 108539253
N-[2-[(2-benzamidoacetyl)amino]ethyl]-3,4,5-trihydroxybenzamide (PubChem CID 108539253) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[2-[(2-benzamidoacetyl)amino]ethyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[2-[(2-benzamidoacetyl)amino]ethyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108539253 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[2-[(2-benzamidoacetyl)amino]ethyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NCCNC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C18H19N3O6/c22-13-8-12(9-14(23)16(13)25)18(27)20-7-6-19-15(24)10-21-17(26)11-4-2-1-3-5-11/h1-5,8-9,22-23,25H,6-7,10H2,(H,19,24)(H,20,27)(H,21,26) |
| InChIKey | FXZYSFPIEXUCLY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|