C16H15FN2O5 — CID 108540166
N-[2-[(3-fluorobenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide (PubChem CID 108540166) has the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. Its IUPAC name is N-[2-[(3-fluorobenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[2-[(3-fluorobenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108540166 |
| Molecular Formula | C16H15FN2O5 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[2-[(3-fluorobenzoyl)amino]ethyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(NCCNC(=O)c1cc(O)c(O)c(O)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H15FN2O5/c17-11-3-1-2-9(6-11)15(23)18-4-5-19-16(24)10-7-12(20)14(22)13(21)8-10/h1-3,6-8,20-22H,4-5H2,(H,18,23)(H,19,24) |
| InChIKey | JKWYIMGHDNIDED-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|