C11H14FNO3 — CID 60654478
3-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide (PubChem CID 60654478) has the molecular formula C11H14FNO3 and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 60654478 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-fluoro-N-[2-(2-hydroxyethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCCO)c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO3/c12-10-3-1-2-9(8-10)11(15)13-4-6-16-7-5-14/h1-3,8,14H,4-7H2,(H,13,15) |
| InChIKey | XLERBHNIKCTXFB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|