C9H12ClFN2O — CID 175851405
N-(2-aminoethyl)-3-fluorobenzamide;hydrochloride (PubChem CID 175851405) has the molecular formula C9H12ClFN2O and a molecular weight of 218.66 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-fluorobenzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 175851405 |
| Molecular Formula | C9H12ClFN2O |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | N-(2-aminoethyl)-3-fluorobenzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C9H11FN2O.ClH/c10-8-3-1-2-7(6-8)9(13)12-5-4-11;/h1-3,6H,4-5,11H2,(H,12,13);1H |
| InChIKey | HFYLCWYHPNXOLQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |