C12H18N4O2 — CID 54754655
1-N,3-N-bis(2-aminoethyl)benzene-1,3-dicarboxamide (PubChem CID 54754655) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-N,3-N-bis(2-aminoethyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-aminoethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 54754655 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-N,3-N-bis(2-aminoethyl)benzene-1,3-dicarboxamide |
| SMILES | NCCNC(=O)c1cccc(C(=O)NCCN)c1 |
| InChI | InChI=1S/C12H18N4O2/c13-4-6-15-11(17)9-2-1-3-10(8-9)12(18)16-7-5-14/h1-3,8H,4-7,13-14H2,(H,15,17)(H,16,18) |
| InChIKey | MAGHRAPVPMMAHM-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |